| Ürün adı: | Polietilen Glikol Polipropilen Glikol AllilEter Metil Sonu | Yapı: | CH2=CHCH2O(C2H4O)n(C3H6O)mCH3 |
|---|---|---|---|
| CAS No.: | 52232-27-6 | Başvuru: | Polieter modifiye edilmiş polidimetilsiloksan |
Polyethylene Glycol Polypropylene Glycol AllylEther Methyl Ending MW1000 Description: Structure: CH2=CHCH2O(C2H4O)n(C3H6O)mCH3 CAS No.: 52232-27-6 Quality Specifications: INSPECTION UNIT SPECIFICATION Color APHA 150 Max. Unsaturation mmol/g 0.8 Min. Hydroxyl Value mgKOH/g 15 Max. Acid Value mgKOH/g 0.15 Max. Moisture % 0.2 Max. K+ Na+ ppm 20 Max. Main Application: Because the active hydrogen of the end-side hydroxyl is replaced by the methyl, so the reaction of the hydroxyl